C29H20O8 — CID 162704125
4-[bis(4-carboxyphenyl)-(4-formyloxyphenyl)methyl]benzoic acid (PubChem CID 162704125) has the molecular formula C29H20O8 and a molecular weight of 496.47 g/mol. Its IUPAC name is 4-[bis(4-carboxyphenyl)-(4-formyloxyphenyl)methyl]benzoic acid.
| Compound Name | 4-[bis(4-carboxyphenyl)-(4-formyloxyphenyl)methyl]benzoic acid |
|---|---|
| PubChem CID | 162704125 |
| Molecular Formula | C29H20O8 |
| Molecular Weight | 496.47 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | 4-[bis(4-carboxyphenyl)-(4-formyloxyphenyl)methyl]benzoic acid |
| SMILES | O=COc1ccc(C(c2ccc(C(=O)O)cc2)(c2ccc(C(=O)O)cc2)c2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C29H20O8/c30-17-37-25-15-13-24(14-16-25)29(21-7-1-18(2-8-21)26(31)32,22-9-3-19(4-10-22)27(33)34)23-11-5-20(6-12-23)28(35)36/h1-17H,(H,31,32)(H,33,34)(H,35,36) |
| InChIKey | XIUNXYSZVMFRLW-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.47 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|