C41H28N2O10 — CID 158262910
4-[(4-carboxyphenyl)diazenyl]benzoic acid;4-[3-(4-carboxyphenyl)-5-(4-formyloxyphenyl)phenyl]benzoic acid (PubChem CID 158262910) has the molecular formula C41H28N2O10 and a molecular weight of 708.68 g/mol. Its IUPAC name is 4-[(4-carboxyphenyl)diazenyl]benzoic acid;4-[3-(4-carboxyphenyl)-5-(4-formyloxyphenyl)phenyl]benzoic acid.
| Compound Name | 4-[(4-carboxyphenyl)diazenyl]benzoic acid;4-[3-(4-carboxyphenyl)-5-(4-formyloxyphenyl)phenyl]benzoic acid |
|---|---|
| PubChem CID | 158262910 |
| Molecular Formula | C41H28N2O10 |
| Molecular Weight | 708.68 g/mol |
| Exact Mass | 708.17 |
| IUPAC Name | 4-[(4-carboxyphenyl)diazenyl]benzoic acid;4-[3-(4-carboxyphenyl)-5-(4-formyloxyphenyl)phenyl]benzoic acid |
| SMILES | O=C(O)c1ccc(/N=N/c2ccc(C(=O)O)cc2)cc1.O=COc1ccc(-c2cc(-c3ccc(C(=O)O)cc3)cc(-c3ccc(C(=O)O)cc3)c2)cc1 |
| InChI | InChI=1S/C27H18O6.C14H10N2O4/c28-16-33-25-11-9-19(10-12-25)24-14-22(17-1-5-20(6-2-17)26(29)30)13-23(15-24)18-3-7-21(8-4-18)27(31)32;17-13(18)9-1-5-11(6-2-9)15-16-12-7-3-10(4-8-12)14(19)20/h1-16H,(H,29,30)(H,31,32);1-8H,(H,17,18)(H,19,20)/b;16-15+ |
| InChIKey | GICAXHDBEZZMQS-ZICVVLIHSA-N |
| XLogP | 9.12 |
| TPSA | 200.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.68 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|