C27H22O6 — CID 155629634
4-[(1S,2R,3R,4S)-2-acetyl-3-benzoyl-4-(4-formyloxyphenyl)cyclobutyl]benzoic acid (PubChem CID 155629634) has the molecular formula C27H22O6 and a molecular weight of 442.47 g/mol. Its IUPAC name is 4-[(1S,2R,3R,4S)-2-acetyl-3-benzoyl-4-(4-formyloxyphenyl)cyclobutyl]benzoic acid.
| Compound Name | 4-[(1S,2R,3R,4S)-2-acetyl-3-benzoyl-4-(4-formyloxyphenyl)cyclobutyl]benzoic acid |
|---|---|
| PubChem CID | 155629634 |
| Molecular Formula | C27H22O6 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 4-[(1S,2R,3R,4S)-2-acetyl-3-benzoyl-4-(4-formyloxyphenyl)cyclobutyl]benzoic acid |
| SMILES | CC(=O)[C@H]1[C@H](C(=O)c2ccccc2)[C@@H](c2ccc(OC=O)cc2)[C@@H]1c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C27H22O6/c1-16(29)22-23(17-7-9-20(10-8-17)27(31)32)24(18-11-13-21(14-12-18)33-15-28)25(22)26(30)19-5-3-2-4-6-19/h2-15,22-25H,1H3,(H,31,32)/t22-,23-,24+,25+/m1/s1 |
| InChIKey | VCFCVEUWPIPAIV-NGSHPTGOSA-N |
| XLogP | 4.51 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|