C26H21FO5 — CID 155223276
4-[(1R)-3-acetyl-2-(4-carboxyphenyl)-4-phenylcyclobutyl]-3-fluorobenzoic acid (PubChem CID 155223276) has the molecular formula C26H21FO5 and a molecular weight of 432.45 g/mol. Its IUPAC name is 4-[(1R)-3-acetyl-2-(4-carboxyphenyl)-4-phenylcyclobutyl]-3-fluorobenzoic acid.
| Compound Name | 4-[(1R)-3-acetyl-2-(4-carboxyphenyl)-4-phenylcyclobutyl]-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 155223276 |
| Molecular Formula | C26H21FO5 |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 4-[(1R)-3-acetyl-2-(4-carboxyphenyl)-4-phenylcyclobutyl]-3-fluorobenzoic acid |
| SMILES | CC(=O)C1C(c2ccccc2)[C@@H](c2ccc(C(=O)O)cc2F)C1c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C26H21FO5/c1-14(28)21-22(15-5-3-2-4-6-15)24(19-12-11-18(26(31)32)13-20(19)27)23(21)16-7-9-17(10-8-16)25(29)30/h2-13,21-24H,1H3,(H,29,30)(H,31,32)/t21?,22?,23?,24-/m1/s1 |
| InChIKey | KIXGHIDAPKCCKF-YRTVTSRJSA-N |
| XLogP | 5.09 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |