C17H19ClN2O2 — CID 171184918
(4R)-4-[4-(benzylamino)phenyl]-1,3-oxazinan-2-one;hydrochloride (PubChem CID 171184918) has the molecular formula C17H19ClN2O2 and a molecular weight of 318.80 g/mol. Its IUPAC name is (4R)-4-[4-(benzylamino)phenyl]-1,3-oxazinan-2-one;hydrochloride.
| Compound Name | (4R)-4-[4-(benzylamino)phenyl]-1,3-oxazinan-2-one;hydrochloride |
|---|---|
| PubChem CID | 171184918 |
| Molecular Formula | C17H19ClN2O2 |
| Molecular Weight | 318.80 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | (4R)-4-[4-(benzylamino)phenyl]-1,3-oxazinan-2-one;hydrochloride |
| SMILES | Cl.O=C1N[C@@H](c2ccc(NCc3ccccc3)cc2)CCO1 |
| InChI | InChI=1S/C17H18N2O2.ClH/c20-17-19-16(10-11-21-17)14-6-8-15(9-7-14)18-12-13-4-2-1-3-5-13;/h1-9,16,18H,10-12H2,(H,19,20);1H/t16-;/m1./s1 |
| InChIKey | RLQAWUWXSHLBDB-PKLMIRHRSA-N |
| XLogP | 3.89 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.80 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |