C10H10ClF2NO2 — CID 171184997
(4R)-4-(3,5-difluorophenyl)-1,3-oxazinan-2-one;hydrochloride (PubChem CID 171184997) has the molecular formula C10H10ClF2NO2 and a molecular weight of 249.64 g/mol. Its IUPAC name is (4R)-4-(3,5-difluorophenyl)-1,3-oxazinan-2-one;hydrochloride.
| Compound Name | (4R)-4-(3,5-difluorophenyl)-1,3-oxazinan-2-one;hydrochloride |
|---|---|
| PubChem CID | 171184997 |
| Molecular Formula | C10H10ClF2NO2 |
| Molecular Weight | 249.64 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | (4R)-4-(3,5-difluorophenyl)-1,3-oxazinan-2-one;hydrochloride |
| SMILES | Cl.O=C1N[C@@H](c2cc(F)cc(F)c2)CCO1 |
| InChI | InChI=1S/C10H9F2NO2.ClH/c11-7-3-6(4-8(12)5-7)9-1-2-15-10(14)13-9;/h3-5,9H,1-2H2,(H,13,14);1H/t9-;/m1./s1 |
| InChIKey | CFHYGNXDWIVDRT-SBSPUUFOSA-N |
| XLogP | 2.56 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.64 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |