C12H17F2NO3 — CID 143702720
4-(3,5-difluorophenyl)-1,3-oxazolidin-2-one;ethane;methanol (PubChem CID 143702720) has the molecular formula C12H17F2NO3 and a molecular weight of 261.27 g/mol. Its IUPAC name is 4-(3,5-difluorophenyl)-1,3-oxazolidin-2-one;ethane;methanol.
| Compound Name | 4-(3,5-difluorophenyl)-1,3-oxazolidin-2-one;ethane;methanol |
|---|---|
| PubChem CID | 143702720 |
| Molecular Formula | C12H17F2NO3 |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 4-(3,5-difluorophenyl)-1,3-oxazolidin-2-one;ethane;methanol |
| SMILES | CC.CO.O=C1NC(c2cc(F)cc(F)c2)CO1 |
| InChI | InChI=1S/C9H7F2NO2.C2H6.CH4O/c10-6-1-5(2-7(11)3-6)8-4-14-9(13)12-8;2*1-2/h1-3,8H,4H2,(H,12,13);1-2H3;2H,1H3 |
| InChIKey | WYIGHOCNYXWJDA-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |