C9H6F3NO2 — CID 171183886
(4S)-4-(3,4,5-trifluorophenyl)-1,3-oxazolidin-2-one (PubChem CID 171183886) has the molecular formula C9H6F3NO2 and a molecular weight of 217.15 g/mol. Its IUPAC name is (4S)-4-(3,4,5-trifluorophenyl)-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-(3,4,5-trifluorophenyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 171183886 |
| Molecular Formula | C9H6F3NO2 |
| Molecular Weight | 217.15 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | (4S)-4-(3,4,5-trifluorophenyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1N[C@@H](c2cc(F)c(F)c(F)c2)CO1 |
| InChI | InChI=1S/C9H6F3NO2/c10-5-1-4(2-6(11)8(5)12)7-3-15-9(14)13-7/h1-2,7H,3H2,(H,13,14)/t7-/m1/s1 |
| InChIKey | MBBRIVYPAGFYOT-SSDOTTSWSA-N |
| XLogP | 1.88 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.15 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|