C9H6BrF2NO2 — CID 130146009
4-(4-bromo-2,6-difluorophenyl)-1,3-oxazolidin-2-one (PubChem CID 130146009) has the molecular formula C9H6BrF2NO2 and a molecular weight of 278.05 g/mol. Its IUPAC name is 4-(4-bromo-2,6-difluorophenyl)-1,3-oxazolidin-2-one.
| Compound Name | 4-(4-bromo-2,6-difluorophenyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 130146009 |
| Molecular Formula | C9H6BrF2NO2 |
| Molecular Weight | 278.05 g/mol |
| Exact Mass | 276.95 |
| IUPAC Name | 4-(4-bromo-2,6-difluorophenyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1NC(c2c(F)cc(Br)cc2F)CO1 |
| InChI | InChI=1S/C9H6BrF2NO2/c10-4-1-5(11)8(6(12)2-4)7-3-15-9(14)13-7/h1-2,7H,3H2,(H,13,14) |
| InChIKey | MZAWHVPSRSRELO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.05 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |