C9H7BrFNO3 — CID 130146187
4-(6-bromo-3-fluoro-2-hydroxyphenyl)-1,3-oxazolidin-2-one (PubChem CID 130146187) has the molecular formula C9H7BrFNO3 and a molecular weight of 276.06 g/mol. Its IUPAC name is 4-(6-bromo-3-fluoro-2-hydroxyphenyl)-1,3-oxazolidin-2-one.
| Compound Name | 4-(6-bromo-3-fluoro-2-hydroxyphenyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 130146187 |
| Molecular Formula | C9H7BrFNO3 |
| Molecular Weight | 276.06 g/mol |
| Exact Mass | 274.96 |
| IUPAC Name | 4-(6-bromo-3-fluoro-2-hydroxyphenyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1NC(c2c(Br)ccc(F)c2O)CO1 |
| InChI | InChI=1S/C9H7BrFNO3/c10-4-1-2-5(11)8(13)7(4)6-3-15-9(14)12-6/h1-2,6,13H,3H2,(H,12,14) |
| InChIKey | QEVBZJFTHXCYQB-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.06 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|