C11H12N2O4 — CID 171185750
(4S)-4-(4-methyl-3-nitrophenyl)-1,3-oxazinan-2-one (PubChem CID 171185750) has the molecular formula C11H12N2O4 and a molecular weight of 236.23 g/mol. Its IUPAC name is (4S)-4-(4-methyl-3-nitrophenyl)-1,3-oxazinan-2-one.
| Compound Name | (4S)-4-(4-methyl-3-nitrophenyl)-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 171185750 |
| Molecular Formula | C11H12N2O4 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | (4S)-4-(4-methyl-3-nitrophenyl)-1,3-oxazinan-2-one |
| SMILES | Cc1ccc([C@@H]2CCOC(=O)N2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H12N2O4/c1-7-2-3-8(6-10(7)13(15)16)9-4-5-17-11(14)12-9/h2-3,6,9H,4-5H2,1H3,(H,12,14)/t9-/m0/s1 |
| InChIKey | BXSDFEBMGSPAEG-VIFPVBQESA-N |
| XLogP | 2.07 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|