About 3-[4-[(1S,2R)-2-aminocyclopropyl]-3-methoxyphenyl]phenol;hydrochloride
3-[4-[(1S,2R)-2-aminocyclopropyl]-3-methoxyphenyl]phenol;hydrochloride (PubChem CID 66714565) has the molecular formula C16H18ClNO2
and a molecular weight of 291.78 g/mol. Its IUPAC name is 3-[4-[(1S,2R)-2-aminocyclopropyl]-3-methoxyphenyl]phenol;hydrochloride.
Molecular Properties
| Compound Name | 3-[4-[(1S,2R)-2-aminocyclopropyl]-3-methoxyphenyl]phenol;hydrochloride |
| PubChem CID | 66714565 |
| Molecular Formula | C16H18ClNO2 |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 3-[4-[(1S,2R)-2-aminocyclopropyl]-3-methoxyphenyl]phenol;hydrochloride |
| SMILES | COc1cc(-c2cccc(O)c2)ccc1[C@@H]1C[C@H]1N.Cl |
| InChI | InChI=1S/C16H17NO2.ClH/c1-19-16-8-11(10-3-2-4-12(18)7-10)5-6-13(16)14-9-15(14)17;/h2-8,14-15,18H,9,17H2,1H3;1H/t14-,15+;/m0./s1 |
| InChIKey | NMTFRSVJVHMVEI-LDXVYITESA-N |
| XLogP | 3.30 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[4-[(1S,2R)-2-aminocyclopropyl]-3-methoxyphenyl]phenol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[(1S,2R)-2-aminocyclopropyl]-3-methoxyphenyl]phenol;hydrochloride?
The IUPAC name of 3-[4-[(1S,2R)-2-aminocyclopropyl]-3-methoxyphenyl]phenol;hydrochloride (CID 66714565) is 3-[4-[(1S,2R)-2-aminocyclopropyl]-3-methoxyphenyl]phenol;hydrochloride.
What is the SMILES notation for 3-[4-[(1S,2R)-2-aminocyclopropyl]-3-methoxyphenyl]phenol;hydrochloride?
The canonical SMILES for 3-[4-[(1S,2R)-2-aminocyclopropyl]-3-methoxyphenyl]phenol;hydrochloride is COc1cc(-c2cccc(O)c2)ccc1[C@@H]1C[C@H]1N.Cl.
What is the InChIKey of 3-[4-[(1S,2R)-2-aminocyclopropyl]-3-methoxyphenyl]phenol;hydrochloride?
The InChIKey is NMTFRSVJVHMVEI-LDXVYITESA-N. The full InChI is InChI=1S/C16H17NO2.ClH/c1-19-16-8-11(10-3-2-4-12(18)7-10)5-6-13(16)14-9-15(14)17;/h2-8,14-15,18H,9,17H2,1H3;1H/t14-,15+;/m0./s1.
What are the key properties of 3-[4-[(1S,2R)-2-aminocyclopropyl]-3-methoxyphenyl]phenol;hydrochloride?
3-[4-[(1S,2R)-2-aminocyclopropyl]-3-methoxyphenyl]phenol;hydrochloride has a molecular weight of 291.78 g/mol, XLogP of 3.30, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[(1S,2R)-2-aminocyclopropyl]-3-methoxyphenyl]phenol;hydrochloride is sourced from PubChem (CID 66714565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).