C13H17ClO3 — CID 81358770
1-[2-(chloromethyl)cyclopropyl]-2,3,4-trimethoxybenzene (PubChem CID 81358770) has the molecular formula C13H17ClO3 and a molecular weight of 256.73 g/mol. Its IUPAC name is 1-[2-(chloromethyl)cyclopropyl]-2,3,4-trimethoxybenzene.
| Compound Name | 1-[2-(chloromethyl)cyclopropyl]-2,3,4-trimethoxybenzene |
|---|---|
| PubChem CID | 81358770 |
| Molecular Formula | C13H17ClO3 |
| Molecular Weight | 256.73 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 1-[2-(chloromethyl)cyclopropyl]-2,3,4-trimethoxybenzene |
| SMILES | COc1ccc(C2CC2CCl)c(OC)c1OC |
| InChI | InChI=1S/C13H17ClO3/c1-15-11-5-4-9(10-6-8(10)7-14)12(16-2)13(11)17-3/h4-5,8,10H,6-7H2,1-3H3 |
| InChIKey | DWAXBIISCLTNOK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.73 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|