About potassium;4-(2,3-dimethoxyphenyl)-1-hydroxypyrrolidin-2-one;hydride
potassium;4-(2,3-dimethoxyphenyl)-1-hydroxypyrrolidin-2-one;hydride (PubChem CID 173253827) has the molecular formula C12H16KNO4
and a molecular weight of 277.36 g/mol. Its IUPAC name is potassium;4-(2,3-dimethoxyphenyl)-1-hydroxypyrrolidin-2-one;hydride.
Molecular Properties
| Compound Name | potassium;4-(2,3-dimethoxyphenyl)-1-hydroxypyrrolidin-2-one;hydride |
| PubChem CID | 173253827 |
| Molecular Formula | C12H16KNO4 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | potassium;4-(2,3-dimethoxyphenyl)-1-hydroxypyrrolidin-2-one;hydride |
| SMILES | COc1cccc(C2CC(=O)N(O)C2)c1OC.[H-].[K+] |
| InChI | InChI=1S/C12H15NO4.K.H/c1-16-10-5-3-4-9(12(10)17-2)8-6-11(14)13(15)7-8;;/h3-5,8,15H,6-7H2,1-2H3;;/q;+1;-1 |
| InChIKey | IBCRIVLARNMYOW-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|
Analyze potassium;4-(2,3-dimethoxyphenyl)-1-hydroxypyrrolidin-2-one;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;4-(2,3-dimethoxyphenyl)-1-hydroxypyrrolidin-2-one;hydride?
The IUPAC name of potassium;4-(2,3-dimethoxyphenyl)-1-hydroxypyrrolidin-2-one;hydride (CID 173253827) is potassium;4-(2,3-dimethoxyphenyl)-1-hydroxypyrrolidin-2-one;hydride.
What is the SMILES notation for potassium;4-(2,3-dimethoxyphenyl)-1-hydroxypyrrolidin-2-one;hydride?
The canonical SMILES for potassium;4-(2,3-dimethoxyphenyl)-1-hydroxypyrrolidin-2-one;hydride is COc1cccc(C2CC(=O)N(O)C2)c1OC.[H-].[K+].
What is the InChIKey of potassium;4-(2,3-dimethoxyphenyl)-1-hydroxypyrrolidin-2-one;hydride?
The InChIKey is IBCRIVLARNMYOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO4.K.H/c1-16-10-5-3-4-9(12(10)17-2)8-6-11(14)13(15)7-8;;/h3-5,8,15H,6-7H2,1-2H3;;/q;+1;-1.
What are the key properties of potassium;4-(2,3-dimethoxyphenyl)-1-hydroxypyrrolidin-2-one;hydride?
potassium;4-(2,3-dimethoxyphenyl)-1-hydroxypyrrolidin-2-one;hydride has a molecular weight of 277.36 g/mol, XLogP of -1.47, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;4-(2,3-dimethoxyphenyl)-1-hydroxypyrrolidin-2-one;hydride is sourced from PubChem (CID 173253827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).