C12H16KNO4 — CID 173253827
potassium;4-(2,3-dimethoxyphenyl)-1-hydroxypyrrolidin-2-one;hydride (PubChem CID 173253827) has the molecular formula C12H16KNO4 and a molecular weight of 277.36 g/mol. Its IUPAC name is potassium;4-(2,3-dimethoxyphenyl)-1-hydroxypyrrolidin-2-one;hydride.
| Compound Name | potassium;4-(2,3-dimethoxyphenyl)-1-hydroxypyrrolidin-2-one;hydride |
|---|---|
| PubChem CID | 173253827 |
| Molecular Formula | C12H16KNO4 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | potassium;4-(2,3-dimethoxyphenyl)-1-hydroxypyrrolidin-2-one;hydride |
| SMILES | COc1cccc(C2CC(=O)N(O)C2)c1OC.[H-].[K+] |
| InChI | InChI=1S/C12H15NO4.K.H/c1-16-10-5-3-4-9(12(10)17-2)8-6-11(14)13(15)7-8;;/h3-5,8,15H,6-7H2,1-2H3;;/q;+1;-1 |
| InChIKey | IBCRIVLARNMYOW-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|