C20H18N2O5 — CID 1050674
N'-[2-(3,5-dimethylphenoxy)acetyl]-2-oxochromene-3-carbohydrazide (PubChem CID 1050674) has the molecular formula C20H18N2O5 and a molecular weight of 366.37 g/mol. Its IUPAC name is N'-[2-(3,5-dimethylphenoxy)acetyl]-2-oxochromene-3-carbohydrazide.
| Compound Name | N'-[2-(3,5-dimethylphenoxy)acetyl]-2-oxochromene-3-carbohydrazide |
|---|---|
| PubChem CID | 1050674 |
| Molecular Formula | C20H18N2O5 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | N'-[2-(3,5-dimethylphenoxy)acetyl]-2-oxochromene-3-carbohydrazide |
| SMILES | Cc1cc(C)cc(OCC(=O)NNC(=O)c2cc3ccccc3oc2=O)c1 |
| InChI | InChI=1S/C20H18N2O5/c1-12-7-13(2)9-15(8-12)26-11-18(23)21-22-19(24)16-10-14-5-3-4-6-17(14)27-20(16)25/h3-10H,11H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | PPKRINZZVXIVCE-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|