C26H19ClN2O6 — CID 72724823
N'-[2-[4-(3-chlorobenzoyl)-2-methylphenoxy]acetyl]-2-oxochromene-3-carbohydrazide (PubChem CID 72724823) has the molecular formula C26H19ClN2O6 and a molecular weight of 490.90 g/mol. Its IUPAC name is N'-[2-[4-(3-chlorobenzoyl)-2-methylphenoxy]acetyl]-2-oxochromene-3-carbohydrazide.
| Compound Name | N'-[2-[4-(3-chlorobenzoyl)-2-methylphenoxy]acetyl]-2-oxochromene-3-carbohydrazide |
|---|---|
| PubChem CID | 72724823 |
| Molecular Formula | C26H19ClN2O6 |
| Molecular Weight | 490.90 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | N'-[2-[4-(3-chlorobenzoyl)-2-methylphenoxy]acetyl]-2-oxochromene-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)c2cccc(Cl)c2)ccc1OCC(=O)NNC(=O)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C26H19ClN2O6/c1-15-11-18(24(31)17-6-4-7-19(27)12-17)9-10-21(15)34-14-23(30)28-29-25(32)20-13-16-5-2-3-8-22(16)35-26(20)33/h2-13H,14H2,1H3,(H,28,30)(H,29,32) |
| InChIKey | VKLXDSGXURERDT-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.90 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|