C18H16FNO6 — CID 8914732
[2-[(2-methoxybenzoyl)amino]-2-oxoethyl] 2-(3-fluorophenoxy)acetate (PubChem CID 8914732) has the molecular formula C18H16FNO6 and a molecular weight of 361.33 g/mol. Its IUPAC name is [2-[(2-methoxybenzoyl)amino]-2-oxoethyl] 2-(3-fluorophenoxy)acetate.
| Compound Name | [2-[(2-methoxybenzoyl)amino]-2-oxoethyl] 2-(3-fluorophenoxy)acetate |
|---|---|
| PubChem CID | 8914732 |
| Molecular Formula | C18H16FNO6 |
| Molecular Weight | 361.33 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | [2-[(2-methoxybenzoyl)amino]-2-oxoethyl] 2-(3-fluorophenoxy)acetate |
| SMILES | COc1ccccc1C(=O)NC(=O)COC(=O)COc1cccc(F)c1 |
| InChI | InChI=1S/C18H16FNO6/c1-24-15-8-3-2-7-14(15)18(23)20-16(21)10-26-17(22)11-25-13-6-4-5-12(19)9-13/h2-9H,10-11H2,1H3,(H,20,21,23) |
| InChIKey | VOEDNWABINZTQM-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |