C15H13ClN4O4 — CID 2645874
[2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 5-methylpyrazine-2-carboxylate (PubChem CID 2645874) has the molecular formula C15H13ClN4O4 and a molecular weight of 348.75 g/mol. Its IUPAC name is [2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 5-methylpyrazine-2-carboxylate.
| Compound Name | [2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 5-methylpyrazine-2-carboxylate |
|---|---|
| PubChem CID | 2645874 |
| Molecular Formula | C15H13ClN4O4 |
| Molecular Weight | 348.75 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | [2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 5-methylpyrazine-2-carboxylate |
| SMILES | Cc1cnc(C(=O)OCC(=O)NNC(=O)c2ccc(Cl)cc2)cn1 |
| InChI | InChI=1S/C15H13ClN4O4/c1-9-6-18-12(7-17-9)15(23)24-8-13(21)19-20-14(22)10-2-4-11(16)5-3-10/h2-7H,8H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | PTDVOFVFCVZBBI-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.75 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|