C20H17ClN4O2S — CID 43002203
N'-[4-[(4-chlorophenyl)sulfanylmethyl]benzoyl]-5-methylpyrazine-2-carbohydrazide (PubChem CID 43002203) has the molecular formula C20H17ClN4O2S and a molecular weight of 412.90 g/mol. Its IUPAC name is N'-[4-[(4-chlorophenyl)sulfanylmethyl]benzoyl]-5-methylpyrazine-2-carbohydrazide.
| Compound Name | N'-[4-[(4-chlorophenyl)sulfanylmethyl]benzoyl]-5-methylpyrazine-2-carbohydrazide |
|---|---|
| PubChem CID | 43002203 |
| Molecular Formula | C20H17ClN4O2S |
| Molecular Weight | 412.90 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | N'-[4-[(4-chlorophenyl)sulfanylmethyl]benzoyl]-5-methylpyrazine-2-carbohydrazide |
| SMILES | Cc1cnc(C(=O)NNC(=O)c2ccc(CSc3ccc(Cl)cc3)cc2)cn1 |
| InChI | InChI=1S/C20H17ClN4O2S/c1-13-10-23-18(11-22-13)20(27)25-24-19(26)15-4-2-14(3-5-15)12-28-17-8-6-16(21)7-9-17/h2-11H,12H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | PTMUPCWAZLHIFL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.90 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|