C20H17ClN4O3S2 — CID 43070192
N-[4-[[[4-[(4-chlorophenyl)sulfanylmethyl]benzoyl]amino]carbamoyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 43070192) has the molecular formula C20H17ClN4O3S2 and a molecular weight of 460.97 g/mol. Its IUPAC name is N-[4-[[[4-[(4-chlorophenyl)sulfanylmethyl]benzoyl]amino]carbamoyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[4-[[[4-[(4-chlorophenyl)sulfanylmethyl]benzoyl]amino]carbamoyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 43070192 |
| Molecular Formula | C20H17ClN4O3S2 |
| Molecular Weight | 460.97 g/mol |
| Exact Mass | 460.04 |
| IUPAC Name | N-[4-[[[4-[(4-chlorophenyl)sulfanylmethyl]benzoyl]amino]carbamoyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc(C(=O)NNC(=O)c2ccc(CSc3ccc(Cl)cc3)cc2)cs1 |
| InChI | InChI=1S/C20H17ClN4O3S2/c1-12(26)22-20-23-17(11-30-20)19(28)25-24-18(27)14-4-2-13(3-5-14)10-29-16-8-6-15(21)7-9-16/h2-9,11H,10H2,1H3,(H,24,27)(H,25,28)(H,22,23,26) |
| InChIKey | POQIULUOTIDCBZ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.97 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|