C20H20N2O6S — CID 7725538
[2-[2-(cyclopropylcarbamoyl)anilino]-2-oxoethyl] 2-methylsulfonylbenzoate (PubChem CID 7725538) has the molecular formula C20H20N2O6S and a molecular weight of 416.46 g/mol. Its IUPAC name is [2-[2-(cyclopropylcarbamoyl)anilino]-2-oxoethyl] 2-methylsulfonylbenzoate.
| Compound Name | [2-[2-(cyclopropylcarbamoyl)anilino]-2-oxoethyl] 2-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 7725538 |
| Molecular Formula | C20H20N2O6S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | [2-[2-(cyclopropylcarbamoyl)anilino]-2-oxoethyl] 2-methylsulfonylbenzoate |
| SMILES | CS(=O)(=O)c1ccccc1C(=O)OCC(=O)Nc1ccccc1C(=O)NC1CC1 |
| InChI | InChI=1S/C20H20N2O6S/c1-29(26,27)17-9-5-3-7-15(17)20(25)28-12-18(23)22-16-8-4-2-6-14(16)19(24)21-13-10-11-13/h2-9,13H,10-12H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | CGLVDPVYJXVVLG-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |