C20H22N2O4S — CID 7847533
[2-[2-(cyclopropylcarbamoyl)anilino]-2-oxoethyl] 4-ethyl-5-methylthiophene-2-carboxylate (PubChem CID 7847533) has the molecular formula C20H22N2O4S and a molecular weight of 386.47 g/mol. Its IUPAC name is [2-[2-(cyclopropylcarbamoyl)anilino]-2-oxoethyl] 4-ethyl-5-methylthiophene-2-carboxylate.
| Compound Name | [2-[2-(cyclopropylcarbamoyl)anilino]-2-oxoethyl] 4-ethyl-5-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 7847533 |
| Molecular Formula | C20H22N2O4S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | [2-[2-(cyclopropylcarbamoyl)anilino]-2-oxoethyl] 4-ethyl-5-methylthiophene-2-carboxylate |
| SMILES | CCc1cc(C(=O)OCC(=O)Nc2ccccc2C(=O)NC2CC2)sc1C |
| InChI | InChI=1S/C20H22N2O4S/c1-3-13-10-17(27-12(13)2)20(25)26-11-18(23)22-16-7-5-4-6-15(16)19(24)21-14-8-9-14/h4-7,10,14H,3,8-9,11H2,1-2H3,(H,21,24)(H,22,23) |
| InChIKey | TVSMSPZIJIQCHW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |