C25H24N2O6 — CID 40813966
[2-[2-(cyclopentylcarbamoyl)anilino]-2-oxoethyl] 1,4-dihydroxynaphthalene-2-carboxylate (PubChem CID 40813966) has the molecular formula C25H24N2O6 and a molecular weight of 448.48 g/mol. Its IUPAC name is [2-[2-(cyclopentylcarbamoyl)anilino]-2-oxoethyl] 1,4-dihydroxynaphthalene-2-carboxylate.
| Compound Name | [2-[2-(cyclopentylcarbamoyl)anilino]-2-oxoethyl] 1,4-dihydroxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 40813966 |
| Molecular Formula | C25H24N2O6 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | [2-[2-(cyclopentylcarbamoyl)anilino]-2-oxoethyl] 1,4-dihydroxynaphthalene-2-carboxylate |
| SMILES | O=C(COC(=O)c1cc(O)c2ccccc2c1O)Nc1ccccc1C(=O)NC1CCCC1 |
| InChI | InChI=1S/C25H24N2O6/c28-21-13-19(23(30)17-10-4-3-9-16(17)21)25(32)33-14-22(29)27-20-12-6-5-11-18(20)24(31)26-15-7-1-2-8-15/h3-6,9-13,15,28,30H,1-2,7-8,14H2,(H,26,31)(H,27,29) |
| InChIKey | DCJOEAAUYUOHGN-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|