C20H17F2NO4 — CID 8506388
[2-(N-ethyl-4-fluoroanilino)-2-oxoethyl] 5-fluoro-3-methyl-1-benzofuran-2-carboxylate (PubChem CID 8506388) has the molecular formula C20H17F2NO4 and a molecular weight of 373.36 g/mol. Its IUPAC name is [2-(N-ethyl-4-fluoroanilino)-2-oxoethyl] 5-fluoro-3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | [2-(N-ethyl-4-fluoroanilino)-2-oxoethyl] 5-fluoro-3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 8506388 |
| Molecular Formula | C20H17F2NO4 |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | [2-(N-ethyl-4-fluoroanilino)-2-oxoethyl] 5-fluoro-3-methyl-1-benzofuran-2-carboxylate |
| SMILES | CCN(C(=O)COC(=O)c1oc2ccc(F)cc2c1C)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H17F2NO4/c1-3-23(15-7-4-13(21)5-8-15)18(24)11-26-20(25)19-12(2)16-10-14(22)6-9-17(16)27-19/h4-10H,3,11H2,1-2H3 |
| InChIKey | FDJJBAJMPGUPQO-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |