C15H16FNO4 — CID 61383254
methyl 2-[ethyl-(5-fluoro-3-methyl-1-benzofuran-2-carbonyl)amino]acetate (PubChem CID 61383254) has the molecular formula C15H16FNO4 and a molecular weight of 293.29 g/mol. Its IUPAC name is methyl 2-[ethyl-(5-fluoro-3-methyl-1-benzofuran-2-carbonyl)amino]acetate.
| Compound Name | methyl 2-[ethyl-(5-fluoro-3-methyl-1-benzofuran-2-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 61383254 |
| Molecular Formula | C15H16FNO4 |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | methyl 2-[ethyl-(5-fluoro-3-methyl-1-benzofuran-2-carbonyl)amino]acetate |
| SMILES | CCN(CC(=O)OC)C(=O)c1oc2ccc(F)cc2c1C |
| InChI | InChI=1S/C15H16FNO4/c1-4-17(8-13(18)20-3)15(19)14-9(2)11-7-10(16)5-6-12(11)21-14/h5-7H,4,8H2,1-3H3 |
| InChIKey | YQMDSALEFISOAL-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |