C17H11Cl4N3O3 — CID 3495124
[2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 3,4,5,6-tetrachloropyridine-2-carboxylate (PubChem CID 3495124) has the molecular formula C17H11Cl4N3O3 and a molecular weight of 447.11 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 3,4,5,6-tetrachloropyridine-2-carboxylate.
| Compound Name | [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 3,4,5,6-tetrachloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 3495124 |
| Molecular Formula | C17H11Cl4N3O3 |
| Molecular Weight | 447.11 g/mol |
| Exact Mass | 444.96 |
| IUPAC Name | [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 3,4,5,6-tetrachloropyridine-2-carboxylate |
| SMILES | N#CCCN(C(=O)COC(=O)c1nc(Cl)c(Cl)c(Cl)c1Cl)c1ccccc1 |
| InChI | InChI=1S/C17H11Cl4N3O3/c18-12-13(19)15(23-16(21)14(12)20)17(26)27-9-11(25)24(8-4-7-22)10-5-2-1-3-6-10/h1-3,5-6H,4,8-9H2 |
| InChIKey | BVLBEIWWENIEKM-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 83.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.11 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|