C24H22FNO4 — CID 7399136
[2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 2-[(3-methylphenyl)methoxy]benzoate (PubChem CID 7399136) has the molecular formula C24H22FNO4 and a molecular weight of 407.44 g/mol. Its IUPAC name is [2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 2-[(3-methylphenyl)methoxy]benzoate.
| Compound Name | [2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 2-[(3-methylphenyl)methoxy]benzoate |
|---|---|
| PubChem CID | 7399136 |
| Molecular Formula | C24H22FNO4 |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | [2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 2-[(3-methylphenyl)methoxy]benzoate |
| SMILES | Cc1cccc(COc2ccccc2C(=O)OCC(=O)NCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C24H22FNO4/c1-17-5-4-6-19(13-17)15-29-22-8-3-2-7-21(22)24(28)30-16-23(27)26-14-18-9-11-20(25)12-10-18/h2-13H,14-16H2,1H3,(H,26,27) |
| InChIKey | TZBRMPXJSCSXQX-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |