C27H27NO5 — CID 16556425
[2-[4-(butanoylamino)phenyl]-2-oxoethyl] 2-[(3-methylphenyl)methoxy]benzoate (PubChem CID 16556425) has the molecular formula C27H27NO5 and a molecular weight of 445.52 g/mol. Its IUPAC name is [2-[4-(butanoylamino)phenyl]-2-oxoethyl] 2-[(3-methylphenyl)methoxy]benzoate.
| Compound Name | [2-[4-(butanoylamino)phenyl]-2-oxoethyl] 2-[(3-methylphenyl)methoxy]benzoate |
|---|---|
| PubChem CID | 16556425 |
| Molecular Formula | C27H27NO5 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | [2-[4-(butanoylamino)phenyl]-2-oxoethyl] 2-[(3-methylphenyl)methoxy]benzoate |
| SMILES | CCCC(=O)Nc1ccc(C(=O)COC(=O)c2ccccc2OCc2cccc(C)c2)cc1 |
| InChI | InChI=1S/C27H27NO5/c1-3-7-26(30)28-22-14-12-21(13-15-22)24(29)18-33-27(31)23-10-4-5-11-25(23)32-17-20-9-6-8-19(2)16-20/h4-6,8-16H,3,7,17-18H2,1-2H3,(H,28,30) |
| InChIKey | AEJIZIHMDKKSJA-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |