C21H18N2O6 — CID 7966638
[2-[2-cyanoethyl(2,3-dihydro-1,4-benzodioxin-6-yl)amino]-2-oxoethyl] 4-formylbenzoate (PubChem CID 7966638) has the molecular formula C21H18N2O6 and a molecular weight of 394.38 g/mol. Its IUPAC name is [2-[2-cyanoethyl(2,3-dihydro-1,4-benzodioxin-6-yl)amino]-2-oxoethyl] 4-formylbenzoate.
| Compound Name | [2-[2-cyanoethyl(2,3-dihydro-1,4-benzodioxin-6-yl)amino]-2-oxoethyl] 4-formylbenzoate |
|---|---|
| PubChem CID | 7966638 |
| Molecular Formula | C21H18N2O6 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | [2-[2-cyanoethyl(2,3-dihydro-1,4-benzodioxin-6-yl)amino]-2-oxoethyl] 4-formylbenzoate |
| SMILES | N#CCCN(C(=O)COC(=O)c1ccc(C=O)cc1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C21H18N2O6/c22-8-1-9-23(17-6-7-18-19(12-17)28-11-10-27-18)20(25)14-29-21(26)16-4-2-15(13-24)3-5-16/h2-7,12-13H,1,9-11,14H2 |
| InChIKey | TXWHIFMLFJIBSB-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 105.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|