C16H17N5O — CID 71919291
N,N-bis(2-cyanoethyl)-2-(5-cyano-2-methylanilino)acetamide (PubChem CID 71919291) has the molecular formula C16H17N5O and a molecular weight of 295.35 g/mol. Its IUPAC name is N,N-bis(2-cyanoethyl)-2-(5-cyano-2-methylanilino)acetamide.
| Compound Name | N,N-bis(2-cyanoethyl)-2-(5-cyano-2-methylanilino)acetamide |
|---|---|
| PubChem CID | 71919291 |
| Molecular Formula | C16H17N5O |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | N,N-bis(2-cyanoethyl)-2-(5-cyano-2-methylanilino)acetamide |
| SMILES | Cc1ccc(C#N)cc1NCC(=O)N(CCC#N)CCC#N |
| InChI | InChI=1S/C16H17N5O/c1-13-4-5-14(11-19)10-15(13)20-12-16(22)21(8-2-6-17)9-3-7-18/h4-5,10,20H,2-3,8-9,12H2,1H3 |
| InChIKey | WBGBGDBREHXTSI-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 103.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |