C15H17ClN4O — CID 78821492
2-(2-chloro-4-methylanilino)-N,N-bis(2-cyanoethyl)acetamide (PubChem CID 78821492) has the molecular formula C15H17ClN4O and a molecular weight of 304.78 g/mol. Its IUPAC name is 2-(2-chloro-4-methylanilino)-N,N-bis(2-cyanoethyl)acetamide.
| Compound Name | 2-(2-chloro-4-methylanilino)-N,N-bis(2-cyanoethyl)acetamide |
|---|---|
| PubChem CID | 78821492 |
| Molecular Formula | C15H17ClN4O |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 2-(2-chloro-4-methylanilino)-N,N-bis(2-cyanoethyl)acetamide |
| SMILES | Cc1ccc(NCC(=O)N(CCC#N)CCC#N)c(Cl)c1 |
| InChI | InChI=1S/C15H17ClN4O/c1-12-4-5-14(13(16)10-12)19-11-15(21)20(8-2-6-17)9-3-7-18/h4-5,10,19H,2-3,8-9,11H2,1H3 |
| InChIKey | KCSSLQAIEGVXOF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 79.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |