C16H20ClN3OS — CID 3856448
3-(2-chloro-4-methylphenyl)-1-(2-cyanoethyl)-1-(oxolan-2-ylmethyl)thiourea (PubChem CID 3856448) has the molecular formula C16H20ClN3OS and a molecular weight of 337.88 g/mol. Its IUPAC name is 3-(2-chloro-4-methylphenyl)-1-(2-cyanoethyl)-1-(oxolan-2-ylmethyl)thiourea.
| Compound Name | 3-(2-chloro-4-methylphenyl)-1-(2-cyanoethyl)-1-(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 3856448 |
| Molecular Formula | C16H20ClN3OS |
| Molecular Weight | 337.88 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 3-(2-chloro-4-methylphenyl)-1-(2-cyanoethyl)-1-(oxolan-2-ylmethyl)thiourea |
| SMILES | Cc1ccc(NC(=S)N(CCC#N)CC2CCCO2)c(Cl)c1 |
| InChI | InChI=1S/C16H20ClN3OS/c1-12-5-6-15(14(17)10-12)19-16(22)20(8-3-7-18)11-13-4-2-9-21-13/h5-6,10,13H,2-4,8-9,11H2,1H3,(H,19,22) |
| InChIKey | VYIDDCWSFIBKHE-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 48.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.88 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|