C16H23N3OS — CID 98083170
3-[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]-1-(2-cyanoethyl)-1-[[(2S)-oxolan-2-yl]methyl]thiourea (PubChem CID 98083170) has the molecular formula C16H23N3OS and a molecular weight of 305.45 g/mol. Its IUPAC name is 3-[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]-1-(2-cyanoethyl)-1-[[(2S)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 3-[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]-1-(2-cyanoethyl)-1-[[(2S)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 98083170 |
| Molecular Formula | C16H23N3OS |
| Molecular Weight | 305.45 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 3-[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]-1-(2-cyanoethyl)-1-[[(2S)-oxolan-2-yl]methyl]thiourea |
| SMILES | N#CCCN(C[C@@H]1CCCO1)C(=S)N[C@@H]1C[C@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C16H23N3OS/c17-6-2-7-19(11-14-3-1-8-20-14)16(21)18-15-10-12-4-5-13(15)9-12/h4-5,12-15H,1-3,7-11H2,(H,18,21)/t12-,13-,14-,15+/m0/s1 |
| InChIKey | QDRYAODTKJDCNU-ZQDZILKHSA-N |
| XLogP | 2.22 |
| TPSA | 48.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.45 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|