C17H23N3O2 — CID 3305018
1-(2-cyanoethyl)-3-(3,5-dimethylphenyl)-1-(oxolan-2-ylmethyl)urea (PubChem CID 3305018) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 1-(2-cyanoethyl)-3-(3,5-dimethylphenyl)-1-(oxolan-2-ylmethyl)urea.
| Compound Name | 1-(2-cyanoethyl)-3-(3,5-dimethylphenyl)-1-(oxolan-2-ylmethyl)urea |
|---|---|
| PubChem CID | 3305018 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 1-(2-cyanoethyl)-3-(3,5-dimethylphenyl)-1-(oxolan-2-ylmethyl)urea |
| SMILES | Cc1cc(C)cc(NC(=O)N(CCC#N)CC2CCCO2)c1 |
| InChI | InChI=1S/C17H23N3O2/c1-13-9-14(2)11-15(10-13)19-17(21)20(7-4-6-18)12-16-5-3-8-22-16/h9-11,16H,3-5,7-8,12H2,1-2H3,(H,19,21) |
| InChIKey | RKTBWEDHQOZOHF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |