C16H17ClF3N3O2 — CID 4991341
3-[4-chloro-3-(trifluoromethyl)phenyl]-1-(2-cyanoethyl)-1-(oxolan-2-ylmethyl)urea (PubChem CID 4991341) has the molecular formula C16H17ClF3N3O2 and a molecular weight of 375.78 g/mol. Its IUPAC name is 3-[4-chloro-3-(trifluoromethyl)phenyl]-1-(2-cyanoethyl)-1-(oxolan-2-ylmethyl)urea.
| Compound Name | 3-[4-chloro-3-(trifluoromethyl)phenyl]-1-(2-cyanoethyl)-1-(oxolan-2-ylmethyl)urea |
|---|---|
| PubChem CID | 4991341 |
| Molecular Formula | C16H17ClF3N3O2 |
| Molecular Weight | 375.78 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 3-[4-chloro-3-(trifluoromethyl)phenyl]-1-(2-cyanoethyl)-1-(oxolan-2-ylmethyl)urea |
| SMILES | N#CCCN(CC1CCCO1)C(=O)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H17ClF3N3O2/c17-14-5-4-11(9-13(14)16(18,19)20)22-15(24)23(7-2-6-21)10-12-3-1-8-25-12/h4-5,9,12H,1-3,7-8,10H2,(H,22,24) |
| InChIKey | VHVOGCCURCLZMJ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.78 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |