C15H17N3O — CID 51180457
N,N-bis(2-cyanoethyl)-2,4-dimethylbenzamide (PubChem CID 51180457) has the molecular formula C15H17N3O and a molecular weight of 255.32 g/mol. Its IUPAC name is N,N-bis(2-cyanoethyl)-2,4-dimethylbenzamide.
| Compound Name | N,N-bis(2-cyanoethyl)-2,4-dimethylbenzamide |
|---|---|
| PubChem CID | 51180457 |
| Molecular Formula | C15H17N3O |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | N,N-bis(2-cyanoethyl)-2,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)N(CCC#N)CCC#N)c(C)c1 |
| InChI | InChI=1S/C15H17N3O/c1-12-5-6-14(13(2)11-12)15(19)18(9-3-7-16)10-4-8-17/h5-6,11H,3-4,9-10H2,1-2H3 |
| InChIKey | GKSJCJATPIKFFG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 67.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |