C16H22N2O2 — CID 63286185
N-(2-cyanoethyl)-N-(2-methoxyethyl)-2,4,6-trimethylbenzamide (PubChem CID 63286185) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is N-(2-cyanoethyl)-N-(2-methoxyethyl)-2,4,6-trimethylbenzamide.
| Compound Name | N-(2-cyanoethyl)-N-(2-methoxyethyl)-2,4,6-trimethylbenzamide |
|---|---|
| PubChem CID | 63286185 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | N-(2-cyanoethyl)-N-(2-methoxyethyl)-2,4,6-trimethylbenzamide |
| SMILES | COCCN(CCC#N)C(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C16H22N2O2/c1-12-10-13(2)15(14(3)11-12)16(19)18(7-5-6-17)8-9-20-4/h10-11H,5,7-9H2,1-4H3 |
| InChIKey | YDHMNKSAXDZQTQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |