C16H19N3OS — CID 30422819
N,N-bis(2-cyanoethyl)-2-(2,4-dimethylphenyl)sulfanylacetamide (PubChem CID 30422819) has the molecular formula C16H19N3OS and a molecular weight of 301.42 g/mol. Its IUPAC name is N,N-bis(2-cyanoethyl)-2-(2,4-dimethylphenyl)sulfanylacetamide.
| Compound Name | N,N-bis(2-cyanoethyl)-2-(2,4-dimethylphenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 30422819 |
| Molecular Formula | C16H19N3OS |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | N,N-bis(2-cyanoethyl)-2-(2,4-dimethylphenyl)sulfanylacetamide |
| SMILES | Cc1ccc(SCC(=O)N(CCC#N)CCC#N)c(C)c1 |
| InChI | InChI=1S/C16H19N3OS/c1-13-5-6-15(14(2)11-13)21-12-16(20)19(9-3-7-17)10-4-8-18/h5-6,11H,3-4,9-10,12H2,1-2H3 |
| InChIKey | SQGVYRUAWRNRMU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 67.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |