C17H15NOS — CID 43225040
4-[2-(2,4-dimethylphenyl)sulfanylacetyl]benzonitrile (PubChem CID 43225040) has the molecular formula C17H15NOS and a molecular weight of 281.38 g/mol. Its IUPAC name is 4-[2-(2,4-dimethylphenyl)sulfanylacetyl]benzonitrile.
| Compound Name | 4-[2-(2,4-dimethylphenyl)sulfanylacetyl]benzonitrile |
|---|---|
| PubChem CID | 43225040 |
| Molecular Formula | C17H15NOS |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 4-[2-(2,4-dimethylphenyl)sulfanylacetyl]benzonitrile |
| SMILES | Cc1ccc(SCC(=O)c2ccc(C#N)cc2)c(C)c1 |
| InChI | InChI=1S/C17H15NOS/c1-12-3-8-17(13(2)9-12)20-11-16(19)15-6-4-14(10-18)5-7-15/h3-9H,11H2,1-2H3 |
| InChIKey | NWRFBOBDGOPZEA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |