C14H14N4O4 — CID 32698814
N,N-bis(2-cyanoethyl)-2-(3-nitrophenoxy)acetamide (PubChem CID 32698814) has the molecular formula C14H14N4O4 and a molecular weight of 302.29 g/mol. Its IUPAC name is N,N-bis(2-cyanoethyl)-2-(3-nitrophenoxy)acetamide.
| Compound Name | N,N-bis(2-cyanoethyl)-2-(3-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 32698814 |
| Molecular Formula | C14H14N4O4 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | N,N-bis(2-cyanoethyl)-2-(3-nitrophenoxy)acetamide |
| SMILES | N#CCCN(CCC#N)C(=O)COc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H14N4O4/c15-6-2-8-17(9-3-7-16)14(19)11-22-13-5-1-4-12(10-13)18(20)21/h1,4-5,10H,2-3,8-9,11H2 |
| InChIKey | VGOOKROUIZKSBU-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 120.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|