C17H17N5O6 — CID 55316659
[2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 2-[(3-nitrobenzoyl)amino]acetate (PubChem CID 55316659) has the molecular formula C17H17N5O6 and a molecular weight of 387.35 g/mol. Its IUPAC name is [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 2-[(3-nitrobenzoyl)amino]acetate.
| Compound Name | [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 2-[(3-nitrobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 55316659 |
| Molecular Formula | C17H17N5O6 |
| Molecular Weight | 387.35 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 2-[(3-nitrobenzoyl)amino]acetate |
| SMILES | N#CCCN(CCC#N)C(=O)COC(=O)CNC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H17N5O6/c18-6-2-8-21(9-3-7-19)15(23)12-28-16(24)11-20-17(25)13-4-1-5-14(10-13)22(26)27/h1,4-5,10H,2-3,8-9,11-12H2,(H,20,25) |
| InChIKey | BAWTXCGHRFQDRJ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 166.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.35 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|