C13H12N4O3 — CID 2205161
N,N-bis(2-cyanoethyl)-3-nitrobenzamide (PubChem CID 2205161) has the molecular formula C13H12N4O3 and a molecular weight of 272.26 g/mol. Its IUPAC name is N,N-bis(2-cyanoethyl)-3-nitrobenzamide.
| Compound Name | N,N-bis(2-cyanoethyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 2205161 |
| Molecular Formula | C13H12N4O3 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | N,N-bis(2-cyanoethyl)-3-nitrobenzamide |
| SMILES | N#CCCN(CCC#N)C(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H12N4O3/c14-6-2-8-16(9-3-7-15)13(18)11-4-1-5-12(10-11)17(19)20/h1,4-5,10H,2-3,8-9H2 |
| InChIKey | ZFKMYJTXAFZOJX-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 111.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|