C12H11N3O2 — CID 842502
N,N-bis(cyanomethyl)-2-phenoxyacetamide (PubChem CID 842502) has the molecular formula C12H11N3O2 and a molecular weight of 229.24 g/mol. Its IUPAC name is N,N-bis(cyanomethyl)-2-phenoxyacetamide.
| Compound Name | N,N-bis(cyanomethyl)-2-phenoxyacetamide |
|---|---|
| PubChem CID | 842502 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | N,N-bis(cyanomethyl)-2-phenoxyacetamide |
| SMILES | N#CCN(CC#N)C(=O)COc1ccccc1 |
| InChI | InChI=1S/C12H11N3O2/c13-6-8-15(9-7-14)12(16)10-17-11-4-2-1-3-5-11/h1-5H,8-10H2 |
| InChIKey | UGBPFCQGOMLZMC-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 77.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|