C19H17N3O3 — CID 60613009
N,N-bis(cyanomethyl)-2-[4-(4-methylphenoxy)phenoxy]acetamide (PubChem CID 60613009) has the molecular formula C19H17N3O3 and a molecular weight of 335.36 g/mol. Its IUPAC name is N,N-bis(cyanomethyl)-2-[4-(4-methylphenoxy)phenoxy]acetamide.
| Compound Name | N,N-bis(cyanomethyl)-2-[4-(4-methylphenoxy)phenoxy]acetamide |
|---|---|
| PubChem CID | 60613009 |
| Molecular Formula | C19H17N3O3 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | N,N-bis(cyanomethyl)-2-[4-(4-methylphenoxy)phenoxy]acetamide |
| SMILES | Cc1ccc(Oc2ccc(OCC(=O)N(CC#N)CC#N)cc2)cc1 |
| InChI | InChI=1S/C19H17N3O3/c1-15-2-4-17(5-3-15)25-18-8-6-16(7-9-18)24-14-19(23)22(12-10-20)13-11-21/h2-9H,12-14H2,1H3 |
| InChIKey | PTZXKKXUEPQORA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 86.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|