C17H20N2O5S — CID 18080929
[2-oxo-2-(propylcarbamoylamino)ethyl] 3-(methylsulfanylmethyl)-1-benzofuran-2-carboxylate (PubChem CID 18080929) has the molecular formula C17H20N2O5S and a molecular weight of 364.42 g/mol. Its IUPAC name is [2-oxo-2-(propylcarbamoylamino)ethyl] 3-(methylsulfanylmethyl)-1-benzofuran-2-carboxylate.
| Compound Name | [2-oxo-2-(propylcarbamoylamino)ethyl] 3-(methylsulfanylmethyl)-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 18080929 |
| Molecular Formula | C17H20N2O5S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | [2-oxo-2-(propylcarbamoylamino)ethyl] 3-(methylsulfanylmethyl)-1-benzofuran-2-carboxylate |
| SMILES | CCCNC(=O)NC(=O)COC(=O)c1oc2ccccc2c1CSC |
| InChI | InChI=1S/C17H20N2O5S/c1-3-8-18-17(22)19-14(20)9-23-16(21)15-12(10-25-2)11-6-4-5-7-13(11)24-15/h4-7H,3,8-10H2,1-2H3,(H2,18,19,20,22) |
| InChIKey | YKEHNVFPRDNAGC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |