C26H22N2O6 — CID 34772261
[2-[3-(methylcarbamoyl)anilino]-2-oxoethyl] 3-(phenoxymethyl)-1-benzofuran-2-carboxylate (PubChem CID 34772261) has the molecular formula C26H22N2O6 and a molecular weight of 458.47 g/mol. Its IUPAC name is [2-[3-(methylcarbamoyl)anilino]-2-oxoethyl] 3-(phenoxymethyl)-1-benzofuran-2-carboxylate.
| Compound Name | [2-[3-(methylcarbamoyl)anilino]-2-oxoethyl] 3-(phenoxymethyl)-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 34772261 |
| Molecular Formula | C26H22N2O6 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | [2-[3-(methylcarbamoyl)anilino]-2-oxoethyl] 3-(phenoxymethyl)-1-benzofuran-2-carboxylate |
| SMILES | CNC(=O)c1cccc(NC(=O)COC(=O)c2oc3ccccc3c2COc2ccccc2)c1 |
| InChI | InChI=1S/C26H22N2O6/c1-27-25(30)17-8-7-9-18(14-17)28-23(29)16-33-26(31)24-21(15-32-19-10-3-2-4-11-19)20-12-5-6-13-22(20)34-24/h2-14H,15-16H2,1H3,(H,27,30)(H,28,29) |
| InChIKey | LVFJHJILSSXRNF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |