C20H18N2O6 — CID 30019126
ethyl 3-[[3-(carbamoylamino)benzoyl]oxymethyl]-1-benzofuran-2-carboxylate (PubChem CID 30019126) has the molecular formula C20H18N2O6 and a molecular weight of 382.37 g/mol. Its IUPAC name is ethyl 3-[[3-(carbamoylamino)benzoyl]oxymethyl]-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 3-[[3-(carbamoylamino)benzoyl]oxymethyl]-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 30019126 |
| Molecular Formula | C20H18N2O6 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | ethyl 3-[[3-(carbamoylamino)benzoyl]oxymethyl]-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1oc2ccccc2c1COC(=O)c1cccc(NC(N)=O)c1 |
| InChI | InChI=1S/C20H18N2O6/c1-2-26-19(24)17-15(14-8-3-4-9-16(14)28-17)11-27-18(23)12-6-5-7-13(10-12)22-20(21)25/h3-10H,2,11H2,1H3,(H3,21,22,25) |
| InChIKey | LFKYDQWODHVEDU-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |