C23H25NO7S — CID 16560210
ethyl 3-[[4-(diethylsulfamoyl)benzoyl]oxymethyl]-1-benzofuran-2-carboxylate (PubChem CID 16560210) has the molecular formula C23H25NO7S and a molecular weight of 459.52 g/mol. Its IUPAC name is ethyl 3-[[4-(diethylsulfamoyl)benzoyl]oxymethyl]-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 3-[[4-(diethylsulfamoyl)benzoyl]oxymethyl]-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 16560210 |
| Molecular Formula | C23H25NO7S |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | ethyl 3-[[4-(diethylsulfamoyl)benzoyl]oxymethyl]-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1oc2ccccc2c1COC(=O)c1ccc(S(=O)(=O)N(CC)CC)cc1 |
| InChI | InChI=1S/C23H25NO7S/c1-4-24(5-2)32(27,28)17-13-11-16(12-14-17)22(25)30-15-19-18-9-7-8-10-20(18)31-21(19)23(26)29-6-3/h7-14H,4-6,15H2,1-3H3 |
| InChIKey | KFPYJHIJESSLHN-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |