C21H20O6 — CID 2660302
(4-methoxycarbonylphenyl)methyl 3-(ethoxymethyl)-1-benzofuran-2-carboxylate (PubChem CID 2660302) has the molecular formula C21H20O6 and a molecular weight of 368.39 g/mol. Its IUPAC name is (4-methoxycarbonylphenyl)methyl 3-(ethoxymethyl)-1-benzofuran-2-carboxylate.
| Compound Name | (4-methoxycarbonylphenyl)methyl 3-(ethoxymethyl)-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 2660302 |
| Molecular Formula | C21H20O6 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | (4-methoxycarbonylphenyl)methyl 3-(ethoxymethyl)-1-benzofuran-2-carboxylate |
| SMILES | CCOCc1c(C(=O)OCc2ccc(C(=O)OC)cc2)oc2ccccc12 |
| InChI | InChI=1S/C21H20O6/c1-3-25-13-17-16-6-4-5-7-18(16)27-19(17)21(23)26-12-14-8-10-15(11-9-14)20(22)24-2/h4-11H,3,12-13H2,1-2H3 |
| InChIKey | APKJHTJHGSGNRE-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |