C13H16N6OS — CID 122298559
4-methyl-N-(2-piperidin-1-ylpyrimidin-5-yl)thiadiazole-5-carboxamide (PubChem CID 122298559) has the molecular formula C13H16N6OS and a molecular weight of 304.38 g/mol. Its IUPAC name is 4-methyl-N-(2-piperidin-1-ylpyrimidin-5-yl)thiadiazole-5-carboxamide.
| Compound Name | 4-methyl-N-(2-piperidin-1-ylpyrimidin-5-yl)thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 122298559 |
| Molecular Formula | C13H16N6OS |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 4-methyl-N-(2-piperidin-1-ylpyrimidin-5-yl)thiadiazole-5-carboxamide |
| SMILES | Cc1nnsc1C(=O)Nc1cnc(N2CCCCC2)nc1 |
| InChI | InChI=1S/C13H16N6OS/c1-9-11(21-18-17-9)12(20)16-10-7-14-13(15-8-10)19-5-3-2-4-6-19/h7-8H,2-6H2,1H3,(H,16,20) |
| InChIKey | LDOAMMICCPPCJO-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 83.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |